CAS 256473-04-8 is the registry number for 2-Chloro-3-(2,2,2-trifluoroethoxy)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-chloro-3-(2,2,2-trifluoroethoxy)pyridine (CAS 256473-04-8) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 2-chloro-3-(2,2,2-trifluoroethoxy)pyridine. InChIKey: IUTMJBMTEOTFKB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 2-chloro-3-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | IUTMJBMTEOTFKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)OCC(F)(F)F |
Computed by PubChem (NCBI)