cas: 1320397-15-6 — see every product listed under this CAS number, including other names
2–Chloro–6–methylpyridine–4–boronic acid (CAS 1320397-15-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF36170-100mg |
| cas | 1320397-15-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 554.92 Pln | |
| GLPBio | 1g | 1125.94 Pln | |
| GLPBio | 250mg | 681.29 Pln | |
| GLPBio | 5g | 2951.33 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-chloro-6-methyl-4-pyridinyl)boronic acid (CAS 1320397-15-6) is a chemical compound with the molecular formula C6H7BClNO2 and a molecular weight of 171.39 g/mol. IUPAC name: (2-chloro-6-methyl-4-pyridinyl)boronic acid. InChIKey: OUDHMBLTDQMBOV-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO2 |
|---|---|
| Molecular weight | 171.39 g/mol |
| IUPAC name | (2-chloro-6-methyl-4-pyridinyl)boronic acid |
| InChIKey | OUDHMBLTDQMBOV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)C)(O)O |
Computed by PubChem (NCBI)