Products 1003043-40-0

CAS 1003043-40-0 appears in our catalog under these names: 2-Chloro-3-methylpyridine-5-boronic acid, 98%, 6–Chloro–5–methylpyridine–3–boronic acid, 2-Chloro-3-methylpyridine-5-boronic Acid (contains varying amounts of Anhydride), (6-Chloro-5-methylpyridin-3-yl)boronic acid 97%, (6-Chloro-5-methylpyridin-3-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 10g, 500g, 250mg, 50g.

Structural formula: {0} (CAS {1})

(6-chloro-5-methyl-3-pyridinyl)boronic acid (CAS 1003043-40-0) is a chemical compound with the molecular formula C6H7BClNO2 and a molecular weight of 171.39 g/mol. IUPAC name: (6-chloro-5-methyl-3-pyridinyl)boronic acid. InChIKey: WWOOKOBRTKSRLV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BClNO2
Molecular weight171.39 g/mol
IUPAC name(6-chloro-5-methyl-3-pyridinyl)boronic acid
InChIKeyWWOOKOBRTKSRLV-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1)Cl)C)(O)O

Computed by PubChem (NCBI)