Products 1541177-08-5
CAS 1541177-08-5 is the registry number for (4-Amino-2-chlorophenyl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-amino-2-chlorophenyl)boronic acid (CAS 1541177-08-5) is a chemical compound with the molecular formula C6H7BClNO2 and a molecular weight of 171.39 g/mol. IUPAC name: (4-amino-2-chlorophenyl)boronic acid. InChIKey: ZDNYEXMGPJHBQY-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO2 |
|---|---|
| Molecular weight | 171.39 g/mol |
| IUPAC name | (4-amino-2-chlorophenyl)boronic acid |
| InChIKey | ZDNYEXMGPJHBQY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-amino-2-chlorophenyl)boronic acid