Products 1320397-15-6
CAS 1320397-15-6 appears in our catalog under these names: 2–Chloro–6–methylpyridine–4–boronic acid, 2-Chloro-6-methylpyridine-4-boronic acid, 98%, (2-Chloro-6-methylpyridin-4-yl)boronic acid 98%, (2-Chloro-6-methylpyridin-4-yl)boronic acid, 96%, 96%, (2-Chloro-6-methylpyridin-4-yl)boronic acid, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(2-chloro-6-methyl-4-pyridinyl)boronic acid (CAS 1320397-15-6) is a chemical compound with the molecular formula C6H7BClNO2 and a molecular weight of 171.39 g/mol. IUPAC name: (2-chloro-6-methyl-4-pyridinyl)boronic acid. InChIKey: OUDHMBLTDQMBOV-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO2 |
|---|---|
| Molecular weight | 171.39 g/mol |
| IUPAC name | (2-chloro-6-methyl-4-pyridinyl)boronic acid |
| InChIKey | OUDHMBLTDQMBOV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)C)(O)O |
Computed by PubChem (NCBI)