cas: 946598-40-9 — see every product listed under this CAS number, including other names
2–Fluoro–4–morpholinobenzoic Acid (CAS 946598-40-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF35559-100mg |
| cas | 946598-40-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 531.51 Pln | |
| GLPBio | 1g | 788.94 Pln | |
| GLPBio | 250mg | 573.64 Pln | |
| GLPBio | 5g | 1720.36 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-fluoro-4-morpholin-4-ylbenzoic acid (CAS 946598-40-9) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: 2-fluoro-4-morpholin-4-ylbenzoic acid. InChIKey: NEWHCWSPQLPAIR-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 2-fluoro-4-morpholin-4-ylbenzoic acid |
| InChIKey | NEWHCWSPQLPAIR-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)