CAS 875312-64-4 is the registry number for (2R,4R)-4-Amino-6-fluoro-2-methylchroman-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
(2R,4R)-4-amino-6-fluoro-2-methyl-2,3-dihydrochromene-4-carboxylic acid (CAS 875312-64-4) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: (2R,4R)-4-amino-6-fluoro-2-methyl-2,3-dihydrochromene-4-carboxylic acid. InChIKey: IFJLLYGZXTWBJC-KSBSHMNSSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | (2R,4R)-4-amino-6-fluoro-2-methyl-2,3-dihydrochromene-4-carboxylic acid |
| InChIKey | IFJLLYGZXTWBJC-KSBSHMNSSA-N |
| SMILES | C[C@@H]1C[C@@](C2=C(O1)C=CC(=C2)F)(C(=O)O)N |
Computed by PubChem (NCBI)