Products 1951441-47-6
CAS 1951441-47-6 is the registry number for 4-Fluoro-3,3-dimethyl-7-nitro-indan-1-ol, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroinden-1-ol (CAS 1951441-47-6) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: 4-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroinden-1-ol. InChIKey: QVVSLVRKYDDYHU-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 4-fluoro-3,3-dimethyl-7-nitro-1,2-dihydroinden-1-ol |
| InChIKey | QVVSLVRKYDDYHU-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C(C=CC(=C21)F)[N+](=O)[O-])O)C |
Computed by PubChem (NCBI)