CAS 588708-72-9 appears in our catalog under these names: 3-Fluoro-4-morpholinobenzoic acid, 98%, 3–Fluoro–4–morpholinobenzoic Acid, 3-Fluoro-4-morpholinobenzoic acid, 3-Fluoro-4-morpholinobenzoic Acid 98%, 3-Fluoro-4-morpholinobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 2,5g, 250mg, 100mg.
3-fluoro-4-morpholin-4-ylbenzoic acid (CAS 588708-72-9) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: 3-fluoro-4-morpholin-4-ylbenzoic acid. InChIKey: WDOYQIXUKGKGHT-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 3-fluoro-4-morpholin-4-ylbenzoic acid |
| InChIKey | WDOYQIXUKGKGHT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)