CAS 78842-13-4 appears in our catalog under these names: 2'-Deoxy-2'-fluoroguanosine, 5 g, 2'-Deoxy-2'-fluoroguanosine, 98%, Guanosine Impurity 9, 2′–Deoxy–2′–fluoroguanosine, 2′-Deoxy-2′-fluoroguanosine/ 99.82% (existing batch purity). Offered by: Roth, Combi-blocks, Chemat Brand, GLPBio, TargetMol. Available pack sizes: 5g, 25g, 1g, 250mg, on request, 100mg, 10mM (in 1ml dmso), 200mg.
2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 78842-13-4) is a chemical compound with the molecular formula C10H12FN5O4 and a molecular weight of 285.23 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: UXUZARPLRQRNNX-DXTOWSMRSA-N.
| Molecular formula | C10H12FN5O4 |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | UXUZARPLRQRNNX-DXTOWSMRSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)F)N=C(NC2=O)N |
Computed by PubChem (NCBI)