Products 4576-87-8

CAS 4576-87-8 is the registry number for 4,5-Dibromoisothiazole-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4,5-dibromo-1,2-thiazole-3-carboxylic acid (CAS 4576-87-8) is a chemical compound with the molecular formula C4HBr2NO2S and a molecular weight of 286.93 g/mol. IUPAC name: 4,5-dibromo-1,2-thiazole-3-carboxylic acid. InChIKey: DWUCNGUOKOLMDG-UHFFFAOYSA-N.

Identity
Molecular formulaC4HBr2NO2S
Molecular weight286.93 g/mol
IUPAC name4,5-dibromo-1,2-thiazole-3-carboxylic acid
InChIKeyDWUCNGUOKOLMDG-UHFFFAOYSA-N
SMILESC1(=C(SN=C1C(=O)O)Br)Br

Computed by PubChem (NCBI)