CAS 139669-96-8 appears in our catalog under these names: 2,4-Dibromo-5-thiazolecarboxylic acid, 95%, 2,4-Dibromothiazole-5-carboxylic acid, 98%, 98%, 2,4-Dibromothiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 10g, 100g.
2,4-dibromo-1,3-thiazole-5-carboxylic acid (CAS 139669-96-8) is a chemical compound with the molecular formula C4HBr2NO2S and a molecular weight of 286.93 g/mol. IUPAC name: 2,4-dibromo-1,3-thiazole-5-carboxylic acid. InChIKey: VHMOYJYPQAAQJZ-UHFFFAOYSA-N.
| Molecular formula | C4HBr2NO2S |
|---|---|
| Molecular weight | 286.93 g/mol |
| IUPAC name | 2,4-dibromo-1,3-thiazole-5-carboxylic acid |
| InChIKey | VHMOYJYPQAAQJZ-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(S1)Br)Br)C(=O)O |
Computed by PubChem (NCBI)