cas: 6109-54-2 — see every product listed under this CAS number, including other names
2,5-Bis(benzyloxy)benzaldehyde, 98%, 98% (CAS 6109-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FW3-100mg |
| cas | 6109-54-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1062.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-bis(phenylmethoxy)benzaldehyde (CAS 6109-54-2) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: 2,5-bis(phenylmethoxy)benzaldehyde. InChIKey: MPNYEOHUDBSABW-UHFFFAOYSA-N.
| Molecular formula | C21H18O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 2,5-bis(phenylmethoxy)benzaldehyde |
| InChIKey | MPNYEOHUDBSABW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)OCC3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)