Products 1355248-18-8

CAS 1355248-18-8 is the registry number for 3-(4-Benzyloxyphenyl)phenylacetic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[3-(4-phenylmethoxyphenyl)phenyl]acetic acid (CAS 1355248-18-8) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: 2-[3-(4-phenylmethoxyphenyl)phenyl]acetic acid. InChIKey: SGUBMDDENSLKJX-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18O3
Molecular weight318.4 g/mol
IUPAC name2-[3-(4-phenylmethoxyphenyl)phenyl]acetic acid
InChIKeySGUBMDDENSLKJX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=C(C=C2)C3=CC=CC(=C3)CC(=O)O

Computed by PubChem (NCBI)