CAS 1420800-42-5 is the registry number for 2-Benzyloxy-6-methylbiphenyl-3'-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g.
3-(2-methyl-6-phenylmethoxyphenyl)benzoic acid (CAS 1420800-42-5) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: 3-(2-methyl-6-phenylmethoxyphenyl)benzoic acid. InChIKey: FAGKSKKDYFQVFJ-UHFFFAOYSA-N.
| Molecular formula | C21H18O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 3-(2-methyl-6-phenylmethoxyphenyl)benzoic acid |
| InChIKey | FAGKSKKDYFQVFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OCC2=CC=CC=C2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)