Products 893736-53-3

CAS 893736-53-3 is the registry number for Methyl 3'-(benzyloxy)[1,1'-biphenyl]-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-(3-phenylmethoxyphenyl)benzoate (CAS 893736-53-3) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: methyl 3-(3-phenylmethoxyphenyl)benzoate. InChIKey: NJQSUQXSIWMNLL-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18O3
Molecular weight318.4 g/mol
IUPAC namemethyl 3-(3-phenylmethoxyphenyl)benzoate
InChIKeyNJQSUQXSIWMNLL-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)