Products 852228-14-9

CAS 852228-14-9 appears in our catalog under these names: 2,5-Dibromopyridine-3-boronic acid, 97%, 97%, (2,5-Dibromopyridin-3-yl)boronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2,5-dibromo-3-pyridinyl)boronic acid (CAS 852228-14-9) is a chemical compound with the molecular formula C5H4BBr2NO2 and a molecular weight of 280.71 g/mol. IUPAC name: (2,5-dibromo-3-pyridinyl)boronic acid. InChIKey: CBWWZYPUCZRZGD-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BBr2NO2
Molecular weight280.71 g/mol
IUPAC name(2,5-dibromo-3-pyridinyl)boronic acid
InChIKeyCBWWZYPUCZRZGD-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1Br)Br)(O)O

Computed by PubChem (NCBI)