cas: 4132-86-9 — see every product listed under this CAS number, including other names
2-(((Benzyloxy)carbonyl)amino)propanoic acid, 99.97% (CAS 4132-86-9) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W012381-500 g |
| cas | 4132-86-9 |
| size | 500 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 1044.16 Pln | |
| MedChemExpress | 100 g | 347.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.97% |
2-(phenylmethoxycarbonylamino)propanoic acid (CAS 4132-86-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: TYRGLVWXHJRKMT-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | TYRGLVWXHJRKMT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)