CAS 4132-86-9 appears in our catalog under these names: Z-Dl-ala-oh, 98%, Z–DL–Ala–OH, N-Benzyloxycarbonyl-DL-alanine, >99.0%(HPLC)(T), Cbz-DL-Ala-OH 98%, 2-(((Benzyloxy)carbonyl)amino)propanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 25g, 5g, 10g, 500 g, 100 g.
2-(phenylmethoxycarbonylamino)propanoic acid (CAS 4132-86-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: TYRGLVWXHJRKMT-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | TYRGLVWXHJRKMT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)