cas: 4132-86-9 — see every product listed under this CAS number, including other names
2-(((Benzyloxy)carbonyl)amino)propanoic acid, 98% (CAS 4132-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093738-100G |
| cas | 4132-86-9 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 227.02 Pln | |
| Fluorochem | 500g | 799.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(phenylmethoxycarbonylamino)propanoic acid (CAS 4132-86-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: TYRGLVWXHJRKMT-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | TYRGLVWXHJRKMT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)