cas: 39889-69-5 — see every product listed under this CAS number, including other names
2-((1,1'-Biphenyl)-4-yl)acetyl chloride, 97% (CAS 39889-69-5) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A882750-25g |
| cas | 39889-69-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 9040.78 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-phenylphenyl)acetyl chloride (CAS 39889-69-5) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-(4-phenylphenyl)acetyl chloride. InChIKey: HWTMLSYLXGLSDF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(4-phenylphenyl)acetyl chloride |
| InChIKey | HWTMLSYLXGLSDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)Cl |
Computed by PubChem (NCBI)