CAS 75629-62-8 appears in our catalog under these names: (indol-3-ylmethylene)methane-1,1-dicarbonitrile, 2-((1H-Indol-3-yl)methylene)malononitrile, 98%, 98%, 2-(1h-Indol-3-ylmethylidene)propanedinitrile. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1000mg, 5000mg, 2000mg, 100mg, 1g.
2-(1H-indol-3-ylmethylidene)propanedinitrile (CAS 75629-62-8) is a chemical compound with the molecular formula C12H7N3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(1H-indol-3-ylmethylidene)propanedinitrile. InChIKey: KCGMQWDGOQQAGN-UHFFFAOYSA-N.
| Molecular formula | C12H7N3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-(1H-indol-3-ylmethylidene)propanedinitrile |
| InChIKey | KCGMQWDGOQQAGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C=C(C#N)C#N |
Computed by PubChem (NCBI)