cas: 55749-30-9 — see every product listed under this CAS number, including other names
2-((4,6-Dimethylpyrimidin-2-yl)thio)acetic acid, 98%, 98% (CAS 55749-30-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D8Y0-1g |
| cas | 55749-30-9 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 611.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetic acid (CAS 55749-30-9) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetic acid. InChIKey: ZISGTWODACVVLQ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetic acid |
| InChIKey | ZISGTWODACVVLQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC(=O)O)C |
Computed by PubChem (NCBI)