CAS 162651-10-7 is the registry number for 2-(Cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 162651-10-7) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-(cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: MSFNCZKXXFXTHP-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-(cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | MSFNCZKXXFXTHP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2CC2)C(=O)O |
Computed by PubChem (NCBI)