Products 162651-10-7

CAS 162651-10-7 is the registry number for 2-(Cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 162651-10-7) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-(cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: MSFNCZKXXFXTHP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2S
Molecular weight198.24 g/mol
IUPAC name2-(cyclopropylamino)-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyMSFNCZKXXFXTHP-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)NC2CC2)C(=O)O

Computed by PubChem (NCBI)