CAS 848324-33-4 appears in our catalog under these names: 2-Amino-4,7-dihydro-5h-thieno[2,3-c]pyran-3-carboxamide, 95%, 2-Amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide 95+%, 2-Amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide, 95+%, 95+%, 2-AMINO-4,7-DIHYDRO-5H-THIENO[2,3-C]PYRAN-3-CARBOXAMIDE, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide (CAS 848324-33-4) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide. InChIKey: NXXFLPNSJIRRSJ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide |
| InChIKey | NXXFLPNSJIRRSJ-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C(=C(S2)N)C(=O)N |
Computed by PubChem (NCBI)