CAS 134136-03-1 appears in our catalog under these names: 2-Amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylic acid, 95%, 2-Amino-4,5,6,7-tetrahydrobenzo(d)thiazole-6-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylic acid (CAS 134136-03-1) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylic acid. InChIKey: PABNPIILXVLZMR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | PABNPIILXVLZMR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)SC(=N2)N |
Computed by PubChem (NCBI)