cas: 100418-33-5 — see every product listed under this CAS number, including other names
2-((4-Methyl-2-nitrophenyl)amino)ethanol (CAS 100418-33-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1112Y9-1g |
| cas | 100418-33-5 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 25g | 582.80 Pln | |
| Chemat | 100g | 1341.20 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 25g | 1122.54 Pln | |
| Fluorochem | 100g | 2195.08 Pln |
| delivery time | 3 weeks |
|---|
2-(4-methyl-2-nitroanilino)ethanol (CAS 100418-33-5) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 2-(4-methyl-2-nitroanilino)ethanol. InChIKey: SCZQUWZLEIYDBD-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-(4-methyl-2-nitroanilino)ethanol |
| InChIKey | SCZQUWZLEIYDBD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)