CAS 712321-46-5 appears in our catalog under these names: (R)-3-Amino-3-(6-methoxy-3-pyridyl)-propionic acid, 97%, (R)-3-Amino-3-(6-methoxypyridin-3-yl)propanoic acid, 95+%, (R)–3–Amino–3–(6–methoxypyridin–3–yl)propanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3R)-3-amino-3-(6-methoxy-3-pyridinyl)propanoic acid (CAS 712321-46-5) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: (3R)-3-amino-3-(6-methoxy-3-pyridinyl)propanoic acid. InChIKey: JWSDJSZHYFNBEN-SSDOTTSWSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | (3R)-3-amino-3-(6-methoxy-3-pyridinyl)propanoic acid |
| InChIKey | JWSDJSZHYFNBEN-SSDOTTSWSA-N |
| SMILES | COC1=NC=C(C=C1)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)