CAS 937669-19-7 appears in our catalog under these names: 3-(4,6-Dimethyl-2-oxo-1,2-dihydropyrimidin-5-yl)propanoic acid, 95%, 3-(2-Hydroxy-4,6-dimethylpyrimidin-5-yl)propanoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 750mg.
3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid (CAS 937669-19-7) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid. InChIKey: ONPLCUHLIAMYCI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid |
| InChIKey | ONPLCUHLIAMYCI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=O)N1)C)CCC(=O)O |
Computed by PubChem (NCBI)