CAS 6627-95-8 appears in our catalog under these names: 2-Butoxy-5-nitropyridine, 95%, 2-Butoxy-5-nitropyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-butoxy-5-nitropyridine (CAS 6627-95-8) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 2-butoxy-5-nitropyridine. InChIKey: GEMGCBQSLUFODV-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-butoxy-5-nitropyridine |
| InChIKey | GEMGCBQSLUFODV-UHFFFAOYSA-N |
| SMILES | CCCCOC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)