2-((tert-Butoxycarbonyl)amino)cyclopropanecarboxylic acid 97%
cas: 1083181-22-9 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)cyclopropanecarboxylic acid 97% (CAS 1083181-22-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A800157-50mg |
| cas | 1083181-22-9 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 487.19 Pln | |
| Ambeed | 100mg | 570.62 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2155.94 Pln | |
| Ambeed | 5g | 9353.81 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A800157 |
2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1083181-22-9) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: NOZMNADEEKQWGO-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | NOZMNADEEKQWGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-{[(tert-butoxy)carbonyl]amino}cyclopropane-1-carboxylic acid, 2-(((tert-butoxy)carbonyl)amino)cyclopropane-1-carboxylic acid, 2-(tert-butoxycarbonylamino)cyclopropanecarboxylic acid, 2-((tert-Butoxycarbonyl)amino)cyclopropanecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]cyclopropanecarboxylic acid, 2-Bocamino-cyclopropanecarboxylic acid, 2-Boc-amino-cyclopropanecarboxylic acid, 2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid, Cyclopropanecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, 2-((tert-butoxycarbonyl)amino)cyclopropane-1-carboxylic acid