cas: 249762-02-5 — see every product listed under this CAS number, including other names
2-(1-((tert-Butoxycarbonyl)amino)cyclobutyl)acetic acid, 95%, 95% (CAS 249762-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Q3F-100mg |
| cas | 249762-02-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 500mg | 664.40 Pln | |
| Chemat | 1g | 1134.80 Pln | |
| Chemat | 5g | 3813.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]acetic acid (CAS 249762-02-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]acetic acid. InChIKey: NGHWWOXFYMDOPV-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]acetic acid |
| InChIKey | NGHWWOXFYMDOPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC1)CC(=O)O |
Computed by PubChem (NCBI)