cas: 850567-54-3 — see every product listed under this CAS number, including other names
2-(1-(4-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% mix TBC as stabilizer, 98% mix TBC as stabilizer (CAS 850567-54-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EOP-100mg |
| cas | 850567-54-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1835.60 Pln |
| purity | 98% mix TBC as stabilizer |
|---|---|
| delivery time | 3 weeks |
2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850567-54-3) is a chemical compound with the molecular formula C14H18BClO2 and a molecular weight of 264.56 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JGSGBFKOANEXOW-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO2 |
|---|---|
| Molecular weight | 264.56 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JGSGBFKOANEXOW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)