cas: 850567-54-3 — see every product listed under this CAS number, including other names
2-(1-(4-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850567-54-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216099-100MG |
| cas | 850567-54-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 1g | 3012.50 Pln |
| delivery time | 3-4 weeks |
|---|
2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850567-54-3) is a chemical compound with the molecular formula C14H18BClO2 and a molecular weight of 264.56 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JGSGBFKOANEXOW-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO2 |
|---|---|
| Molecular weight | 264.56 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JGSGBFKOANEXOW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)