cas: 2492-30-0 — see every product listed under this CAS number, including other names
2-(1-Phenylethylidene)-1-hydrazinecarboxamide, 98%, 98% (CAS 2492-30-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C396-1g |
| cas | 2492-30-0 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1432.40 Pln | |
| Chemat | 5g | 5210.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(Z)-1-phenylethylideneamino]urea (CAS 2492-30-0) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: [(Z)-1-phenylethylideneamino]urea. InChIKey: CPXYGYOMIMOSCX-XFFZJAGNSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | [(Z)-1-phenylethylideneamino]urea |
| InChIKey | CPXYGYOMIMOSCX-XFFZJAGNSA-N |
| SMILES | C/C(=N/NC(=O)N)/C1=CC=CC=C1 |
Computed by PubChem (NCBI)