cas: 94021-22-4 — see every product listed under this CAS number, including other names
2-(1-Piperazinyl)pyrimidine (dihydrochloride), 98.0% (CAS 94021-22-4) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 50 g, 1 g, 5 g, 10 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W004148-25 g |
| cas | 94021-22-4 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 658.70 Pln | |
| MedChemExpress | 50 g | 983.78 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 333.62 Pln | |
| MedChemExpress | 10 g | 431.15 Pln | |
| MedChemExpress | 100 g | 1471.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
2-piperazin-1-ylpyrimidine;dihydrochloride (CAS 94021-22-4) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 2-piperazin-1-ylpyrimidine;dihydrochloride. InChIKey: ZNZGJSLHXOMREP-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 2-piperazin-1-ylpyrimidine;dihydrochloride |
| InChIKey | ZNZGJSLHXOMREP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)