cas: 94021-22-4 — see every product listed under this CAS number, including other names
2-(Piperazin-1-yl)pyrimidine dihydrochloride, 97% (CAS 94021-22-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337188-10G |
| cas | 94021-22-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1294.35 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-piperazin-1-ylpyrimidine;dihydrochloride (CAS 94021-22-4) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 2-piperazin-1-ylpyrimidine;dihydrochloride. InChIKey: ZNZGJSLHXOMREP-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 2-piperazin-1-ylpyrimidine;dihydrochloride |
| InChIKey | ZNZGJSLHXOMREP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)