cas: 98623-50-8 — see every product listed under this CAS number, including other names
2-(1H-Indol-5-yl)-N-methylethanesulfonamide 97% (CAS 98623-50-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A535377-100mg |
| cas | 98623-50-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1221.44 Pln | |
| Ambeed | 5g | 4130.62 Pln | |
| Ambeed | 25g | 13870.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A535377 |
2-(1H-indol-5-yl)-N-methylethanesulfonamide (CAS 98623-50-8) is a chemical compound with the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. IUPAC name: 2-(1H-indol-5-yl)-N-methylethanesulfonamide. InChIKey: PPXMUBLAPJLGNE-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 2-(1H-indol-5-yl)-N-methylethanesulfonamide |
| InChIKey | PPXMUBLAPJLGNE-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CCC1=CC2=C(C=C1)NC=C2 |
Computed by PubChem (NCBI)