Products 1820735-49-6
CAS 1820735-49-6 is the registry number for N-(2-Cyanophenyl)-N-isopropylmethanesulfonamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
N-(2-cyanophenyl)-N-propan-2-ylmethanesulfonamide (CAS 1820735-49-6) is a chemical compound with the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. IUPAC name: N-(2-cyanophenyl)-N-propan-2-ylmethanesulfonamide. InChIKey: MEFBFYPZJLDXPK-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | N-(2-cyanophenyl)-N-propan-2-ylmethanesulfonamide |
| InChIKey | MEFBFYPZJLDXPK-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=CC=C1C#N)S(=O)(=O)C |
Computed by PubChem (NCBI)