Products 878218-25-8
CAS 878218-25-8 appears in our catalog under these names: 1-(4-Cyanophenyl)-N-isopropylmethanesulfonamide, 98%, 1-(4-Cyanophenyl)-N-isopropylmethanesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g.
1-(4-cyanophenyl)-N-propan-2-ylmethanesulfonamide (CAS 878218-25-8) is a chemical compound with the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. IUPAC name: 1-(4-cyanophenyl)-N-propan-2-ylmethanesulfonamide. InChIKey: JPGWZGPXJCIUHP-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 1-(4-cyanophenyl)-N-propan-2-ylmethanesulfonamide |
| InChIKey | JPGWZGPXJCIUHP-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)CC1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)