CAS 1340429-61-9 is the registry number for 1-(Cyclopropanesulfonyl)-2,3-dihydro-1h-indol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-cyclopropylsulfonyl-2,3-dihydroindol-5-amine (CAS 1340429-61-9) is a chemical compound with the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. IUPAC name: 1-cyclopropylsulfonyl-2,3-dihydroindol-5-amine. InChIKey: QHZGKTUPMGPLNZ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 1-cyclopropylsulfonyl-2,3-dihydroindol-5-amine |
| InChIKey | QHZGKTUPMGPLNZ-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)N2CCC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)