cas: 57946-60-8 — see every product listed under this CAS number, including other names
2-(2,2,2-Trifluoroethoxy)aniline, 98%, 98% (CAS 57946-60-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECXY-1g |
| cas | 57946-60-8 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 544.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,2,2-trifluoroethoxy)aniline (CAS 57946-60-8) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)aniline. InChIKey: JIKIVGTUYSNUPQ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | JIKIVGTUYSNUPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OCC(F)(F)F |
Computed by PubChem (NCBI)