cas: 57946-60-8 — see every product listed under this CAS number, including other names
2-(2,2,2-Trifluoroethoxy)aniline, 98% (CAS 57946-60-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 10g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | SS-5063-25g |
| cas | 57946-60-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| AmBeed | 25g | 3546.34 Pln | |
| AmBeed | 1g | 369.46 Pln | |
| Fluorochem | 100g | 6651.84 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 529.00 Pln | |
| Fluorochem | 10g | 987.17 Pln | |
| Fluorochem | 25g | 2195.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-(2,2,2-trifluoroethoxy)aniline (CAS 57946-60-8) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)aniline. InChIKey: JIKIVGTUYSNUPQ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | JIKIVGTUYSNUPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OCC(F)(F)F |
Computed by PubChem (NCBI)