CAS 160968-99-0 appears in our catalog under these names: 2-(2,2,2-Trifluoroethoxy)phenol, 2–(2,2,2–Trifluoroethoxy)phenol, 2-(2,2,2-Trifluoroethoxy)phenol, 97%, 97%, 2-(2,2,2-Trifluoroethoxy)phenol, 98%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 2,5g, 25g, 5g, 250mg, 1g, 100g.
2-(2,2,2-trifluoroethoxy)phenol (CAS 160968-99-0) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)phenol. InChIKey: VDWGLBLCECKXRU-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)phenol |
| InChIKey | VDWGLBLCECKXRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)O)OCC(F)(F)F |
Computed by PubChem (NCBI)