cas: 1694372-41-2 — see every product listed under this CAS number, including other names
2-(2,2,2-Trifluoroethoxy)pyrimidine-4-carboxylic acid (CAS 1694372-41-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F476514-1G |
| cas | 1694372-41-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4423.46 Pln |
| delivery time | 2-3 weeks |
|---|
2-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxylic acid (CAS 1694372-41-2) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxylic acid. InChIKey: CPCBMHKAKFAUFW-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O3 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxylic acid |
| InChIKey | CPCBMHKAKFAUFW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)