Products 1708178-78-2

CAS 1708178-78-2 is the registry number for 2-(6-Oxo-4-(trifluoromethyl)pyrimidin-1(6h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]acetic acid (CAS 1708178-78-2) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: 2-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]acetic acid. InChIKey: CJHAIJKFQZJQIO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F3N2O3
Molecular weight222.12 g/mol
IUPAC name2-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]acetic acid
InChIKeyCJHAIJKFQZJQIO-UHFFFAOYSA-N
SMILESC1=C(N=CN(C1=O)CC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)