CAS 1346148-15-9 appears in our catalog under these names: 6-(2,2,2-Trifluoroethoxy)pyrazine-2-carboxylic acid, 95%, 6-(2,2,2-Trifluoroethoxy)pyrazine-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
6-(2,2,2-trifluoroethoxy)pyrazine-2-carboxylic acid (CAS 1346148-15-9) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)pyrazine-2-carboxylic acid. InChIKey: PBLLOAGLCLCHSK-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O3 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)pyrazine-2-carboxylic acid |
| InChIKey | PBLLOAGLCLCHSK-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C=N1)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)