cas: 524674-08-6 — see every product listed under this CAS number, including other names
2-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)pyrrolidine 98% (CAS 524674-08-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A355851-100mg |
| cas | 524674-08-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 1032.31 Pln | |
| Ambeed | 5g | 2895.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A355851 |
2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine (CAS 524674-08-6) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine. InChIKey: LSNPFVDQLTUQCE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine |
| InChIKey | LSNPFVDQLTUQCE-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC3=C(C=C2)OCCO3 |
Computed by PubChem (NCBI)