Products 52043-21-7

CAS 52043-21-7 is the registry number for 2-(2,4-Difluorophenoxy)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

2-(2,4-difluorophenoxy)propanoic acid (CAS 52043-21-7) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2-(2,4-difluorophenoxy)propanoic acid. InChIKey: WAKAFGLBHPKARJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O3
Molecular weight202.15 g/mol
IUPAC name2-(2,4-difluorophenoxy)propanoic acid
InChIKeyWAKAFGLBHPKARJ-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=C(C=C(C=C1)F)F

Computed by PubChem (NCBI)