CAS 1431329-81-5 appears in our catalog under these names: 6-Ethoxy-2,3-difluorobenzoic acid, 95%, 6-Ethoxy-2,3-difluorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g.
6-ethoxy-2,3-difluorobenzoic acid (CAS 1431329-81-5) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 6-ethoxy-2,3-difluorobenzoic acid. InChIKey: LKUXFZWPJFDQGP-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 6-ethoxy-2,3-difluorobenzoic acid |
| InChIKey | LKUXFZWPJFDQGP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)